C12H14F3N3O4 — CID 2663284
2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 2663284) has the molecular formula C12H14F3N3O4 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 2663284 |
| Molecular Formula | C12H14F3N3O4 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(C2CCCC2)C1=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O4/c13-12(14,15)6-16-8(19)5-17-9(20)10(21)18(11(17)22)7-3-1-2-4-7/h7H,1-6H2,(H,16,19) |
| InChIKey | HNBCIZZIWAFZPJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|