C17H21N3O4S2 — CID 8954804
2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 8954804) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8954804 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(C2CCCC2)C1=O)NCCSCc1cccs1 |
| InChI | InChI=1S/C17H21N3O4S2/c21-14(18-7-9-25-11-13-6-3-8-26-13)10-19-15(22)16(23)20(17(19)24)12-4-1-2-5-12/h3,6,8,12H,1-2,4-5,7,9-11H2,(H,18,21) |
| InChIKey | ZXUYFKCCQQRALC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|