C18H25N3O3S2 — CID 8943406
2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 8943406) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8943406 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)NCCSCc1cccs1)C2=O |
| InChI | InChI=1S/C18H25N3O3S2/c1-13-5-2-3-7-18(13)16(23)21(17(24)20-18)11-15(22)19-8-10-25-12-14-6-4-9-26-14/h4,6,9,13H,2-3,5,7-8,10-12H2,1H3,(H,19,22)(H,20,24)/t13-,18-/m0/s1 |
| InChIKey | JMEWOOUPDIKGNM-UGSOOPFHSA-N |
| XLogP | 2.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|