C23H27BrN2O4 — CID 26678350
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-methylprop-2-enamide (PubChem CID 26678350) has the molecular formula C23H27BrN2O4 and a molecular weight of 475.38 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26678350 |
| Molecular Formula | C23H27BrN2O4 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(3-methoxy-4-propan-2-yloxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)CC(=O)Nc2ccc(Br)cc2C)ccc1OC(C)C |
| InChI | InChI=1S/C23H27BrN2O4/c1-15(2)30-20-10-6-17(13-21(20)29-5)7-11-23(28)26(4)14-22(27)25-19-9-8-18(24)12-16(19)3/h6-13,15H,14H2,1-5H3,(H,25,27)/b11-7+ |
| InChIKey | SMJPEJKMUMJJKD-YRNVUSSQSA-N |
| XLogP | 4.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|