C18H13F3O4 — CID 26722433
[(1S)-7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl] 2-(difluoromethoxy)benzoate (PubChem CID 26722433) has the molecular formula C18H13F3O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is [(1S)-7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl] 2-(difluoromethoxy)benzoate.
| Compound Name | [(1S)-7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 26722433 |
| Molecular Formula | C18H13F3O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [(1S)-7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl] 2-(difluoromethoxy)benzoate |
| SMILES | C[C@H]1CC(=O)c2c(OC(=O)c3ccccc3OC(F)F)ccc(F)c21 |
| InChI | InChI=1S/C18H13F3O4/c1-9-8-12(22)16-14(7-6-11(19)15(9)16)24-17(23)10-4-2-3-5-13(10)25-18(20)21/h2-7,9,18H,8H2,1H3/t9-/m0/s1 |
| InChIKey | XPTJCLOZJKZUEI-VIFPVBQESA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|