C22H21FO5 — CID 24535197
(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 2-(oxolan-2-ylmethoxy)benzoate (PubChem CID 24535197) has the molecular formula C22H21FO5 and a molecular weight of 384.40 g/mol. Its IUPAC name is (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 2-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 2-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 24535197 |
| Molecular Formula | C22H21FO5 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 2-(oxolan-2-ylmethoxy)benzoate |
| SMILES | CC1CC(=O)c2c(OC(=O)c3ccccc3OCC3CCCO3)ccc(F)c21 |
| InChI | InChI=1S/C22H21FO5/c1-13-11-17(24)21-19(9-8-16(23)20(13)21)28-22(25)15-6-2-3-7-18(15)27-12-14-5-4-10-26-14/h2-3,6-9,13-14H,4-5,10-12H2,1H3 |
| InChIKey | GWRWHPWPOYUNPN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|