C24H31NO3 — CID 26763357
(2S)-N-benzyl-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylpropanamide (PubChem CID 26763357) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 26763357 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-N-benzyl-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylpropanamide |
| SMILES | COc1cc(C)c2c(c1C)[C@H](O)[C@@H]([C@H](C)C(=O)N(C)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H31NO3/c1-15-13-21(28-5)17(3)22-19(15)11-12-20(23(22)26)16(2)24(27)25(4)14-18-9-7-6-8-10-18/h6-10,13,16,20,23,26H,11-12,14H2,1-5H3/t16-,20+,23+/m0/s1 |
| InChIKey | FHRKBQPOQZAXGE-LERMDLETSA-N |
| XLogP | 4.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |