C20H29NO3 — CID 11883209
(2S)-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methyl-N-prop-2-enylpropanamide (PubChem CID 11883209) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2S)-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 11883209 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2S)-2-[(1R,2R)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)[C@@H](C)[C@H]1CCc2c(C)cc(OC)c(C)c2[C@@H]1O |
| InChI | InChI=1S/C20H29NO3/c1-7-10-21(5)20(23)13(3)16-9-8-15-12(2)11-17(24-6)14(4)18(15)19(16)22/h7,11,13,16,19,22H,1,8-10H2,2-6H3/t13-,16+,19+/m0/s1 |
| InChIKey | MVMJQZZGPGKLAO-URKNILKWSA-N |
| XLogP | 3.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|