C18H17N5O5S — CID 26765089
imidazo[1,2-a]pyridin-2-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26765089) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | imidazo[1,2-a]pyridin-2-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26765089 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-yl-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cn2ccccc2n1)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H17N5O5S/c24-18(16-13-21-8-2-1-3-17(21)19-16)20-9-11-22(12-10-20)29(27,28)15-6-4-14(5-7-15)23(25)26/h1-8,13H,9-12H2 |
| InChIKey | MPVJGEDVCBHWTG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|