C20H20ClN3O3S — CID 26846568
(E)-3-(3-chloro-4-methylphenyl)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 26846568) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26846568 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)cc1Cl |
| InChI | InChI=1S/C20H20ClN3O3S/c1-14-7-8-15(12-18(14)21)9-10-20(25)23-16-4-2-5-17(13-16)28(26,27)24-19-6-3-11-22-19/h2,4-5,7-10,12-13H,3,6,11H2,1H3,(H,22,24)(H,23,25)/b10-9+ |
| InChIKey | GPSDZXBXEHVUFX-MDZDMXLPSA-N |
| XLogP | 3.77 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|