C19H20N4O3S2 — CID 3602003
1-(4-acetylphenyl)-3-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]thiourea (PubChem CID 3602003) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 3602003 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-13(24)14-7-9-15(10-8-14)21-19(27)22-16-4-2-5-17(12-16)28(25,26)23-18-6-3-11-20-18/h2,4-5,7-10,12H,3,6,11H2,1H3,(H,20,23)(H2,21,22,27) |
| InChIKey | LWJLAYNGKMTKMG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|