C22H21Cl2N3O2S — CID 26875206
(5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 26875206) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is (5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 26875206 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CC(C)N1CCc2c(sc3c2C(=O)N[C@@H](c2ccc(-c4ccc(Cl)c(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C22H21Cl2N3O2S/c1-11(2)27-8-7-13-18(10-27)30-22-19(13)21(28)25-20(26-22)17-6-5-16(29-17)12-3-4-14(23)15(24)9-12/h3-6,9,11,20,26H,7-8,10H2,1-2H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | JFGVMHBIIWVOLQ-HXUWFJFHSA-N |
| XLogP | 5.94 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |