C21H19Cl2N3O2S — CID 26875958
(5S)-5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 26875958) has the molecular formula C21H19Cl2N3O2S and a molecular weight of 448.38 g/mol. Its IUPAC name is (5S)-5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | (5S)-5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 26875958 |
| Molecular Formula | C21H19Cl2N3O2S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (5S)-5-[5-(3,5-dichlorophenyl)furan-2-yl]-11-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | CCN1CCc2c(sc3c2C(=O)N[C@H](c2ccc(-c4cc(Cl)cc(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C21H19Cl2N3O2S/c1-2-26-6-5-14-17(10-26)29-21-18(14)20(27)24-19(25-21)16-4-3-15(28-16)11-7-12(22)9-13(23)8-11/h3-4,7-9,19,25H,2,5-6,10H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | ZJOVISRHJIDLBY-IBGZPJMESA-N |
| XLogP | 5.55 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |