C25H26Cl2N2O2S — CID 3511136
2-[5-(3,5-dichlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3511136) has the molecular formula C25H26Cl2N2O2S and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[5-(3,5-dichlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[5-(3,5-dichlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3511136 |
| Molecular Formula | C25H26Cl2N2O2S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[5-(3,5-dichlorophenyl)furan-2-yl]-7-(2-methylbutan-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)C1CCc2c(sc3c2C(=O)NC(c2ccc(-c4cc(Cl)cc(Cl)c4)o2)N3)C1 |
| InChI | InChI=1S/C25H26Cl2N2O2S/c1-4-25(2,3)14-5-6-17-20(11-14)32-24-21(17)23(30)28-22(29-24)19-8-7-18(31-19)13-9-15(26)12-16(27)10-13/h7-10,12,14,22,29H,4-6,11H2,1-3H3,(H,28,30) |
| InChIKey | DVZYIMFZBBYEOZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |