C13H18N4O4S — CID 2691273
ethyl 2-acetamido-5-[1-(2-carbamoylhydrazinyl)ethenyl]-4-methylthiophene-3-carboxylate (PubChem CID 2691273) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is ethyl 2-acetamido-5-[1-(2-carbamoylhydrazinyl)ethenyl]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-acetamido-5-[1-(2-carbamoylhydrazinyl)ethenyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2691273 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 2-acetamido-5-[1-(2-carbamoylhydrazinyl)ethenyl]-4-methylthiophene-3-carboxylate |
| SMILES | C=C(NNC(N)=O)c1sc(NC(C)=O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C13H18N4O4S/c1-5-21-12(19)9-6(2)10(7(3)16-17-13(14)20)22-11(9)15-8(4)18/h16H,3,5H2,1-2,4H3,(H,15,18)(H3,14,17,20) |
| InChIKey | HLGSNJOXDULGBN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|