C17H17NO5S — CID 26943220
6,7,8,9-tetrahydrodibenzofuran-2-yl 3,5-dimethyl-1,2-oxazole-4-sulfonate (PubChem CID 26943220) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzofuran-2-yl 3,5-dimethyl-1,2-oxazole-4-sulfonate.
| Compound Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 3,5-dimethyl-1,2-oxazole-4-sulfonate |
|---|---|
| PubChem CID | 26943220 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 3,5-dimethyl-1,2-oxazole-4-sulfonate |
| SMILES | Cc1noc(C)c1S(=O)(=O)Oc1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C17H17NO5S/c1-10-17(11(2)22-18-10)24(19,20)23-12-7-8-16-14(9-12)13-5-3-4-6-15(13)21-16/h7-9H,3-6H2,1-2H3 |
| InChIKey | TYWIPEHDIOLPLZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|