C6H12BrN3S — CID 26974724
N'-[(5S)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine (PubChem CID 26974724) has the molecular formula C6H12BrN3S and a molecular weight of 238.15 g/mol. Its IUPAC name is N'-[(5S)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[(5S)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 26974724 |
| Molecular Formula | C6H12BrN3S |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | N'-[(5S)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethane-1,2-diamine |
| SMILES | NCCNC1=NC[C@@H](CBr)S1 |
| InChI | InChI=1S/C6H12BrN3S/c7-3-5-4-10-6(11-5)9-2-1-8/h5H,1-4,8H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | NVQVEXCIFCALJM-RXMQYKEDSA-N |
| XLogP | 0.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|