C25H23NO5S — CID 26989319
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 26989319) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 26989319 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(OCc2nc(CC(=O)OCc3cc(=O)oc4c(C)c(C)ccc34)cs2)cc1 |
| InChI | InChI=1S/C25H23NO5S/c1-15-4-7-20(8-5-15)29-13-22-26-19(14-32-22)11-23(27)30-12-18-10-24(28)31-25-17(3)16(2)6-9-21(18)25/h4-10,14H,11-13H2,1-3H3 |
| InChIKey | RNIUQFPOKHASDG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|