C22H18N4O6S — CID 55477152
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate (PubChem CID 55477152) has the molecular formula C22H18N4O6S and a molecular weight of 466.48 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 55477152 |
| Molecular Formula | C22H18N4O6S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(OCc2nc(CC(=O)OCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)cs2)cc1 |
| InChI | InChI=1S/C22H18N4O6S/c1-14-2-8-18(9-3-14)30-12-20-23-16(13-33-20)10-21(27)31-11-19-24-25-22(32-19)15-4-6-17(7-5-15)26(28)29/h2-9,13H,10-12H2,1H3 |
| InChIKey | VIQBPPUFWPGOOU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 130.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|