C29H29NO5 — CID 27000900
(4Z)-4-[[4-[2-[2-[(2S)-butan-2-yl]phenoxy]ethoxy]-3-methoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 27000900) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is (4Z)-4-[[4-[2-[2-[(2S)-butan-2-yl]phenoxy]ethoxy]-3-methoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[2-[2-[(2S)-butan-2-yl]phenoxy]ethoxy]-3-methoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 27000900 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (4Z)-4-[[4-[2-[2-[(2S)-butan-2-yl]phenoxy]ethoxy]-3-methoxyphenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC[C@H](C)c1ccccc1OCCOc1ccc(/C=C2\N=C(c3ccccc3)OC2=O)cc1OC |
| InChI | InChI=1S/C29H29NO5/c1-4-20(2)23-12-8-9-13-25(23)33-16-17-34-26-15-14-21(19-27(26)32-3)18-24-29(31)35-28(30-24)22-10-6-5-7-11-22/h5-15,18-20H,4,16-17H2,1-3H3/b24-18-/t20-/m0/s1 |
| InChIKey | TVGSQZVOGVKYSZ-JHMOUWFPSA-N |
| XLogP | 6.01 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|