C28H27NO4 — CID 2266799
(4E)-4-[[4-[2-[2-[(2R)-butan-2-yl]phenoxy]ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 2266799) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (4E)-4-[[4-[2-[2-[(2R)-butan-2-yl]phenoxy]ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[[4-[2-[2-[(2R)-butan-2-yl]phenoxy]ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2266799 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (4E)-4-[[4-[2-[2-[(2R)-butan-2-yl]phenoxy]ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC[C@@H](C)c1ccccc1OCCOc1ccc(/C=C2/N=C(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C28H27NO4/c1-3-20(2)24-11-7-8-12-26(24)32-18-17-31-23-15-13-21(14-16-23)19-25-28(30)33-27(29-25)22-9-5-4-6-10-22/h4-16,19-20H,3,17-18H2,1-2H3/b25-19+/t20-/m1/s1 |
| InChIKey | YDSCZDWVNSEKOM-GBDYGOOCSA-N |
| XLogP | 6.00 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|