C29H27NO6 — CID 3609992
4-[[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 3609992) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3609992 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[[3-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | C=CCc1ccc(OCCOc2ccc(C=C3N=C(c4ccccc4)OC3=O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C29H27NO6/c1-4-8-20-11-13-24(26(18-20)32-2)34-15-16-35-25-14-12-21(19-27(25)33-3)17-23-29(31)36-28(30-23)22-9-6-5-7-10-22/h4-7,9-14,17-19H,1,8,15-16H2,2-3H3 |
| InChIKey | JHOIIRLGOPIFSA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|