C28H24FNO5 — CID 2184929
(4E)-2-(4-fluorophenyl)-4-[[3-methoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2184929) has the molecular formula C28H24FNO5 and a molecular weight of 473.50 g/mol. Its IUPAC name is (4E)-2-(4-fluorophenyl)-4-[[3-methoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-fluorophenyl)-4-[[3-methoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2184929 |
| Molecular Formula | C28H24FNO5 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (4E)-2-(4-fluorophenyl)-4-[[3-methoxy-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | C=CCc1ccccc1OCCOc1ccc(/C=C2/N=C(c3ccc(F)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C28H24FNO5/c1-3-6-20-7-4-5-8-24(20)33-15-16-34-25-14-9-19(18-26(25)32-2)17-23-28(31)35-27(30-23)21-10-12-22(29)13-11-21/h3-5,7-14,17-18H,1,6,15-16H2,2H3/b23-17+ |
| InChIKey | BBWCYHNPQPLNKB-HAVVHWLPSA-N |
| XLogP | 5.37 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|