C23H23N5O5 — CID 27002745
3-[(4Z)-3-methyl-4-[[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]methylidene]-5-oxopyrazol-1-yl]benzoate (PubChem CID 27002745) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[(4Z)-3-methyl-4-[[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]methylidene]-5-oxopyrazol-1-yl]benzoate.
| Compound Name | 3-[(4Z)-3-methyl-4-[[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]methylidene]-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 27002745 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-[(4Z)-3-methyl-4-[[4-(4-methylpiperazin-4-ium-1-yl)-3-nitrophenyl]methylidene]-5-oxopyrazol-1-yl]benzoate |
| SMILES | CC1=NN(c2cccc(C(=O)[O-])c2)C(=O)/C1=C\c1ccc(N2CC[NH+](C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23N5O5/c1-15-19(22(29)27(24-15)18-5-3-4-17(14-18)23(30)31)12-16-6-7-20(21(13-16)28(32)33)26-10-8-25(2)9-11-26/h3-7,12-14H,8-11H2,1-2H3,(H,30,31)/b19-12- |
| InChIKey | FHUJIDCYWFMICR-UNOMPAQXSA-N |
| XLogP | 0.10 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|