C28H25ClN2O — CID 27002842
[(3aR,4R,9bR)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 27002842) has the molecular formula C28H25ClN2O and a molecular weight of 440.97 g/mol. Its IUPAC name is [(3aR,4R,9bR)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [(3aR,4R,9bR)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 27002842 |
| Molecular Formula | C28H25ClN2O |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(3aR,4R,9bR)-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)[C@@H]1C=CC[C@H]1[C@H](c1ccc(Cl)cc1)N2)N1CCCc2ccccc21 |
| InChI | InChI=1S/C28H25ClN2O/c29-21-13-10-19(11-14-21)27-23-8-3-7-22(23)24-17-20(12-15-25(24)30-27)28(32)31-16-4-6-18-5-1-2-9-26(18)31/h1-3,5,7,9-15,17,22-23,27,30H,4,6,8,16H2/t22-,23-,27+/m1/s1 |
| InChIKey | YMDXXZNDQQUJMI-NOTUOJBMSA-N |
| XLogP | 6.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|