C11H20N6O2S — CID 27046259
(2R)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-carbamoyl-3-methylbutanamide (PubChem CID 27046259) has the molecular formula C11H20N6O2S and a molecular weight of 300.39 g/mol. Its IUPAC name is (2R)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-carbamoyl-3-methylbutanamide.
| Compound Name | (2R)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-carbamoyl-3-methylbutanamide |
|---|---|
| PubChem CID | 27046259 |
| Molecular Formula | C11H20N6O2S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2R)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-carbamoyl-3-methylbutanamide |
| SMILES | CC(C)[C@@H](Sc1nnnn1C(C)(C)C)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H20N6O2S/c1-6(2)7(8(18)13-9(12)19)20-10-14-15-16-17(10)11(3,4)5/h6-7H,1-5H3,(H3,12,13,18,19)/t7-/m1/s1 |
| InChIKey | WZYALWIEYFKJPX-SSDOTTSWSA-N |
| XLogP | 0.74 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |