C9H17N5OS — CID 9379297
(2S)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-methylpropanamide (PubChem CID 9379297) has the molecular formula C9H17N5OS and a molecular weight of 243.34 g/mol. Its IUPAC name is (2S)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-methylpropanamide.
| Compound Name | (2S)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 9379297 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (2S)-2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](C)Sc1nnnn1C(C)(C)C |
| InChI | InChI=1S/C9H17N5OS/c1-6(7(15)10-5)16-8-11-12-13-14(8)9(2,3)4/h6H,1-5H3,(H,10,15)/t6-/m0/s1 |
| InChIKey | VWLDWYIJXWYVDG-LURJTMIESA-N |
| XLogP | 0.65 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |