C27H21ClF2N2O4 — CID 27047476
methyl (1R,3aS,6aS)-5-[(4-chlorophenyl)methyl]-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 27047476) has the molecular formula C27H21ClF2N2O4 and a molecular weight of 510.92 g/mol. Its IUPAC name is methyl (1R,3aS,6aS)-5-[(4-chlorophenyl)methyl]-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1R,3aS,6aS)-5-[(4-chlorophenyl)methyl]-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 27047476 |
| Molecular Formula | C27H21ClF2N2O4 |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | methyl (1R,3aS,6aS)-5-[(4-chlorophenyl)methyl]-3,3-bis(4-fluorophenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(c2ccc(F)cc2)(c2ccc(F)cc2)[C@H]2C(=O)N(Cc3ccc(Cl)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H21ClF2N2O4/c1-36-26(35)23-21-22(25(34)32(24(21)33)14-15-2-8-18(28)9-3-15)27(31-23,16-4-10-19(29)11-5-16)17-6-12-20(30)13-7-17/h2-13,21-23,31H,14H2,1H3/t21-,22+,23+/m0/s1 |
| InChIKey | FDVAJUIZJBFVQA-YTFSRNRJSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|