C28H19F7N2O4 — CID 126201276
methyl (1R,3aR,6aR)-5-(4-fluorophenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 126201276) has the molecular formula C28H19F7N2O4 and a molecular weight of 580.46 g/mol. Its IUPAC name is methyl (1R,3aR,6aR)-5-(4-fluorophenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1R,3aR,6aR)-5-(4-fluorophenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126201276 |
| Molecular Formula | C28H19F7N2O4 |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | methyl (1R,3aR,6aR)-5-(4-fluorophenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)[C@@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C28H19F7N2O4/c1-41-25(40)22-20-21(24(39)37(23(20)38)19-12-10-18(29)11-13-19)26(36-22,14-2-6-16(7-3-14)27(30,31)32)15-4-8-17(9-5-15)28(33,34)35/h2-13,20-22,36H,1H3/t20-,21+,22-/m1/s1 |
| InChIKey | SRHOXYDUAGVYFD-BHIFYINESA-N |
| XLogP | 5.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|