C29H22F6N2O5 — CID 126196305
methyl (1R,3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 126196305) has the molecular formula C29H22F6N2O5 and a molecular weight of 592.49 g/mol. Its IUPAC name is methyl (1R,3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1R,3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126196305 |
| Molecular Formula | C29H22F6N2O5 |
| Molecular Weight | 592.49 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | methyl (1R,3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)[C@H]2C(=O)N(c3ccc(OC)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C29H22F6N2O5/c1-41-20-13-11-19(12-14-20)37-24(38)21-22(25(37)39)27(36-23(21)26(40)42-2,15-3-7-17(8-4-15)28(30,31)32)16-5-9-18(10-6-16)29(33,34)35/h3-14,21-23,36H,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | VOIYYSNKHVSGLR-DNVJHFABSA-N |
| XLogP | 4.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|