C32H34F6N2O4 — CID 126295171
methyl (1R,3aR,6aS)-5-(4-tert-butylcyclohexyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 126295171) has the molecular formula C32H34F6N2O4 and a molecular weight of 624.62 g/mol. Its IUPAC name is methyl (1R,3aR,6aS)-5-(4-tert-butylcyclohexyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1R,3aR,6aS)-5-(4-tert-butylcyclohexyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126295171 |
| Molecular Formula | C32H34F6N2O4 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | methyl (1R,3aR,6aS)-5-(4-tert-butylcyclohexyl)-4,6-dioxo-3,3-bis[4-(trifluoromethyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)[C@@H]2C(=O)N(C3CCC(C(C)(C)C)CC3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C32H34F6N2O4/c1-29(2,3)17-13-15-22(16-14-17)40-26(41)23-24(27(40)42)30(39-25(23)28(43)44-4,18-5-9-20(10-6-18)31(33,34)35)19-7-11-21(12-8-19)32(36,37)38/h5-12,17,22-25,39H,13-16H2,1-4H3/t17?,22?,23-,24-,25+/m0/s1 |
| InChIKey | KIRJMCUJQVBSNM-KBTKMPKRSA-N |
| XLogP | 6.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|