C26H21FN2O4 — CID 1211126
methyl (1S,3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3,3-diphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 1211126) has the molecular formula C26H21FN2O4 and a molecular weight of 444.46 g/mol. Its IUPAC name is methyl (1S,3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3,3-diphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | methyl (1S,3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3,3-diphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 1211126 |
| Molecular Formula | C26H21FN2O4 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | methyl (1S,3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3,3-diphenyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@H]1NC(c2ccccc2)(c2ccccc2)[C@@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H21FN2O4/c1-33-25(32)22-20-21(24(31)29(23(20)30)19-14-12-18(27)13-15-19)26(28-22,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,20-22,28H,1H3/t20-,21-,22-/m0/s1 |
| InChIKey | SFARDHVRAWOLKM-FKBYEOEOSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|