C21H18ClNO5 — CID 27059603
methyl 2-[(2R)-1-(4-acetylphenyl)-5-(4-chlorophenyl)-2-hydroxy-3-oxopyrrol-2-yl]acetate (PubChem CID 27059603) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is methyl 2-[(2R)-1-(4-acetylphenyl)-5-(4-chlorophenyl)-2-hydroxy-3-oxopyrrol-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-(4-acetylphenyl)-5-(4-chlorophenyl)-2-hydroxy-3-oxopyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 27059603 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | methyl 2-[(2R)-1-(4-acetylphenyl)-5-(4-chlorophenyl)-2-hydroxy-3-oxopyrrol-2-yl]acetate |
| SMILES | COC(=O)C[C@@]1(O)C(=O)C=C(c2ccc(Cl)cc2)N1c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C21H18ClNO5/c1-13(24)14-5-9-17(10-6-14)23-18(15-3-7-16(22)8-4-15)11-19(25)21(23,27)12-20(26)28-2/h3-11,27H,12H2,1-2H3/t21-/m1/s1 |
| InChIKey | XGXZLBJLYZFTIB-OAQYLSRUSA-N |
| XLogP | 3.22 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |