C25H24ClN5O2 — CID 27105378
4-[[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enoyl]amino]-N,N-dimethylbenzamide (PubChem CID 27105378) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 4-[[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 27105378 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 4-[[(E)-3-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-cyanoprop-2-enoyl]amino]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C(\C#N)C(=O)Nc3ccc(C(=O)N(C)C)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C25H24ClN5O2/c1-16-5-7-18(8-6-16)15-31-23(26)22(17(2)29-31)13-20(14-27)24(32)28-21-11-9-19(10-12-21)25(33)30(3)4/h5-13H,15H2,1-4H3,(H,28,32)/b20-13+ |
| InChIKey | NIPSAOIFIHFHEZ-DEDYPNTBSA-N |
| XLogP | 4.45 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|