C21H19N3O2 — CID 126810028
3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-(furan-3-carbonyl)prop-2-enenitrile (PubChem CID 126810028) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-(furan-3-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-(furan-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126810028 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-2-(furan-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(Cn2nc(C)c(C=C(C#N)C(=O)c3ccoc3)c2C)cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-14-4-6-17(7-5-14)12-24-16(3)20(15(2)23-24)10-19(11-22)21(25)18-8-9-26-13-18/h4-10,13H,12H2,1-3H3 |
| InChIKey | OSYLPEIPMHFRAW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|