C22H20N2S2 — CID 27160257
N,N'-diphenyl-N,N'-dithiophen-2-ylethane-1,2-diamine (PubChem CID 27160257) has the molecular formula C22H20N2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N,N'-diphenyl-N,N'-dithiophen-2-ylethane-1,2-diamine.
| Compound Name | N,N'-diphenyl-N,N'-dithiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 27160257 |
| Molecular Formula | C22H20N2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N,N'-diphenyl-N,N'-dithiophen-2-ylethane-1,2-diamine |
| SMILES | c1ccc(N(CCN(c2ccccc2)c2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H20N2S2/c1-3-9-19(10-4-1)23(21-13-7-17-25-21)15-16-24(22-14-8-18-26-22)20-11-5-2-6-12-20/h1-14,17-18H,15-16H2 |
| InChIKey | AQVQLONPQNFTRU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |