C30H28N2O6 — CID 2716929
3-(4-hydroxyphenyl)imino-9,11,11-trimethyl-6-(3,4,5-trimethoxybenzoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-2-one (PubChem CID 2716929) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)imino-9,11,11-trimethyl-6-(3,4,5-trimethoxybenzoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-2-one.
| Compound Name | 3-(4-hydroxyphenyl)imino-9,11,11-trimethyl-6-(3,4,5-trimethoxybenzoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-2-one |
|---|---|
| PubChem CID | 2716929 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-(4-hydroxyphenyl)imino-9,11,11-trimethyl-6-(3,4,5-trimethoxybenzoyl)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-2-one |
| SMILES | COc1cc(C(=O)c2cc3c4c(c2)/C(=N/c2ccc(O)cc2)C(=O)N4C(C)(C)C=C3C)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N2O6/c1-16-15-30(2,3)32-26-21(16)11-17(27(34)18-13-23(36-4)28(38-6)24(14-18)37-5)12-22(26)25(29(32)35)31-19-7-9-20(33)10-8-19/h7-15,33H,1-6H3/b31-25- |
| InChIKey | MVFUKZWOZVITNW-GDWJVWIDSA-N |
| XLogP | 5.31 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|