C29H34ClNO6 — CID 27210629
2-[9-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-10-ium-10-yl]acetate (PubChem CID 27210629) has the molecular formula C29H34ClNO6 and a molecular weight of 528.05 g/mol. Its IUPAC name is 2-[9-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-10-ium-10-yl]acetate.
| Compound Name | 2-[9-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-10-ium-10-yl]acetate |
|---|---|
| PubChem CID | 27210629 |
| Molecular Formula | C29H34ClNO6 |
| Molecular Weight | 528.05 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-[9-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-10-ium-10-yl]acetate |
| SMILES | C=CCOc1c(Cl)cc(C2C3=C(CC(C)(C)CC3=O)[NH+](CC(=O)[O-])C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C29H34ClNO6/c1-7-8-37-27-17(30)9-16(10-22(27)36-6)24-25-18(11-28(2,3)13-20(25)32)31(15-23(34)35)19-12-29(4,5)14-21(33)26(19)24/h7,9-10,24H,1,8,11-15H2,2-6H3,(H,34,35) |
| InChIKey | MFSRSQNGRFALRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|