C13H22N2O4S — CID 2721596
(2R)-2-amino-3-[(3R)-1-hexyl-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 2721596) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3R)-1-hexyl-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[(3R)-1-hexyl-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 2721596 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2R)-2-amino-3-[(3R)-1-hexyl-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CCCCCCN1C(=O)C[C@@H](SC[C@H](N)C(=O)O)C1=O |
| InChI | InChI=1S/C13H22N2O4S/c1-2-3-4-5-6-15-11(16)7-10(12(15)17)20-8-9(14)13(18)19/h9-10H,2-8,14H2,1H3,(H,18,19)/t9-,10+/m0/s1 |
| InChIKey | VENBUKGMIBBKTQ-VHSXEESVSA-N |
| XLogP | 0.84 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|