C14H19F2N3O — CID 27235394
1-(2,4-difluorophenyl)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]urea (PubChem CID 27235394) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]urea |
|---|---|
| PubChem CID | 27235394 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]urea |
| SMILES | C[C@@H]1CCC[C@H](C)N1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H19F2N3O/c1-9-4-3-5-10(2)19(9)18-14(20)17-13-7-6-11(15)8-12(13)16/h6-10H,3-5H2,1-2H3,(H2,17,18,20)/t9-,10+ |
| InChIKey | XCCZBMWXNKEPEO-AOOOYVTPSA-N |
| XLogP | 3.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |