C4H3N3O4 — CID 4604
View drug profile → oteracil4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid (PubChem CID 4604) has the molecular formula C4H3N3O4 and a molecular weight of 157.09 g/mol. Its IUPAC name is 4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid.
| Compound Name | 4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid |
|---|---|
| PubChem CID | 4604 |
| Molecular Formula | C4H3N3O4 |
| Molecular Weight | 157.09 g/mol |
| Exact Mass | 157.01 |
| IUPAC Name | 4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H3N3O4/c8-2(9)1-5-3(10)7-4(11)6-1/h(H,8,9)(H2,5,6,7,10,11) |
| InChIKey | RYYCJUAHISIHTL-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.09 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |