About 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride
2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride (PubChem CID 2725797) has the molecular formula C11H23ClN2S2
and a molecular weight of 282.91 g/mol. Its IUPAC name is 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride |
| PubChem CID | 2725797 |
| Molecular Formula | C11H23ClN2S2 |
| Molecular Weight | 282.91 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride |
| SMILES | Cl.NCCSC(=S)NC1CCCCCCC1 |
| InChI | InChI=1S/C11H22N2S2.ClH/c12-8-9-15-11(14)13-10-6-4-2-1-3-5-7-10;/h10H,1-9,12H2,(H,13,14);1H |
| InChIKey | RCSABJRYIUXSPJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride?
The IUPAC name of 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride (CID 2725797) is 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride.
What is the SMILES notation for 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride?
The canonical SMILES for 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride is Cl.NCCSC(=S)NC1CCCCCCC1.
What is the InChIKey of 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride?
The InChIKey is RCSABJRYIUXSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S2.ClH/c12-8-9-15-11(14)13-10-6-4-2-1-3-5-7-10;/h10H,1-9,12H2,(H,13,14);1H.
What are the key properties of 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride?
2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride has a molecular weight of 282.91 g/mol, XLogP of 3.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl N-cyclooctylcarbamodithioate;hydrochloride is sourced from PubChem (CID 2725797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).