About hydrazinylmethyl N-cyclopentylcarbamodithioate
hydrazinylmethyl N-cyclopentylcarbamodithioate (PubChem CID 57056282) has the molecular formula C7H15N3S2
and a molecular weight of 205.35 g/mol. Its IUPAC name is hydrazinylmethyl N-cyclopentylcarbamodithioate.
Molecular Properties
| Compound Name | hydrazinylmethyl N-cyclopentylcarbamodithioate |
| PubChem CID | 57056282 |
| Molecular Formula | C7H15N3S2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | hydrazinylmethyl N-cyclopentylcarbamodithioate |
| SMILES | NNCSC(=S)NC1CCCC1 |
| InChI | InChI=1S/C7H15N3S2/c8-9-5-12-7(11)10-6-3-1-2-4-6/h6,9H,1-5,8H2,(H,10,11) |
| InChIKey | INJJHAIMYJZKDV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze hydrazinylmethyl N-cyclopentylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinylmethyl N-cyclopentylcarbamodithioate?
The IUPAC name of hydrazinylmethyl N-cyclopentylcarbamodithioate (CID 57056282) is hydrazinylmethyl N-cyclopentylcarbamodithioate.
What is the SMILES notation for hydrazinylmethyl N-cyclopentylcarbamodithioate?
The canonical SMILES for hydrazinylmethyl N-cyclopentylcarbamodithioate is NNCSC(=S)NC1CCCC1.
What is the InChIKey of hydrazinylmethyl N-cyclopentylcarbamodithioate?
The InChIKey is INJJHAIMYJZKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3S2/c8-9-5-12-7(11)10-6-3-1-2-4-6/h6,9H,1-5,8H2,(H,10,11).
What are the key properties of hydrazinylmethyl N-cyclopentylcarbamodithioate?
hydrazinylmethyl N-cyclopentylcarbamodithioate has a molecular weight of 205.35 g/mol, XLogP of 0.96, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinylmethyl N-cyclopentylcarbamodithioate is sourced from PubChem (CID 57056282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).