C17H9F6N3O2 — CID 2726247
4-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 2726247) has the molecular formula C17H9F6N3O2 and a molecular weight of 401.27 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-3-phenyl-2H-1,2-oxazol-5-one.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-3-phenyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 2726247 |
| Molecular Formula | C17H9F6N3O2 |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | O=c1o[nH]c(-c2ccccc2)c1/N=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F6N3O2/c18-16(19,20)10-6-11(17(21,22)23)8-12(7-10)24-25-14-13(26-28-15(14)27)9-4-2-1-3-5-9/h1-8,26H/b25-24+ |
| InChIKey | QGKGXXQCMMLPES-OCOZRVBESA-N |
| XLogP | 6.09 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|