C11H9NO2 — CID 123578795
4-ethenyl-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 123578795) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-ethenyl-3-phenyl-2H-1,2-oxazol-5-one.
| Compound Name | 4-ethenyl-3-phenyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 123578795 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-ethenyl-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | C=Cc1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C11H9NO2/c1-2-9-10(12-14-11(9)13)8-6-4-3-5-7-8/h2-7,12H,1H2 |
| InChIKey | MXERCDGPKDWMER-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |