C19H17NO2 — CID 11380755
3-phenyl-4-(1-phenylbut-3-enyl)-2H-1,2-oxazol-5-one (PubChem CID 11380755) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-phenyl-4-(1-phenylbut-3-enyl)-2H-1,2-oxazol-5-one.
| Compound Name | 3-phenyl-4-(1-phenylbut-3-enyl)-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 11380755 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-phenyl-4-(1-phenylbut-3-enyl)-2H-1,2-oxazol-5-one |
| SMILES | C=CCC(c1ccccc1)c1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C19H17NO2/c1-2-9-16(14-10-5-3-6-11-14)17-18(20-22-19(17)21)15-12-7-4-8-13-15/h2-8,10-13,16,20H,1,9H2 |
| InChIKey | FLIBKIUTGINARA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|