C20H16N4O4S — CID 27271990
2-[(5R)-3-benzyl-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 27271990) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[(5R)-3-benzyl-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | 2-[(5R)-3-benzyl-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 27271990 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[(5R)-3-benzyl-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(C[C@H]1SC(=O)N(Cc2ccccc2)C1=O)Nn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C20H16N4O4S/c25-17(22-24-12-21-15-9-5-4-8-14(15)18(24)26)10-16-19(27)23(20(28)29-16)11-13-6-2-1-3-7-13/h1-9,12,16H,10-11H2,(H,22,25)/t16-/m1/s1 |
| InChIKey | RGSXTBKDEKRFLP-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|