C17H11Cl2F3N4OS — CID 2727780
1-(2,4-dichlorophenyl)-3-[2-methyl-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]thiourea (PubChem CID 2727780) has the molecular formula C17H11Cl2F3N4OS and a molecular weight of 447.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[2-methyl-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[2-methyl-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 2727780 |
| Molecular Formula | C17H11Cl2F3N4OS |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[2-methyl-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]thiourea |
| SMILES | Cc1cc(-c2nnc(C(F)(F)F)o2)ccc1NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2F3N4OS/c1-8-6-9(14-25-26-15(27-14)17(20,21)22)2-4-12(8)23-16(28)24-13-5-3-10(18)7-11(13)19/h2-7H,1H3,(H2,23,24,28) |
| InChIKey | XHLHOYITQOOGLD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|