C21H29NO2 — CID 2729126
[[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-tert-butylbenzoate (PubChem CID 2729126) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is [[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-tert-butylbenzoate.
| Compound Name | [[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2729126 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | [[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)ON=C2C(C)(C)C3CC[C@]2(C)C3)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-19(2,3)15-9-7-14(8-10-15)17(23)24-22-18-20(4,5)16-11-12-21(18,6)13-16/h7-10,16H,11-13H2,1-6H3/t16?,21-/m1/s1 |
| InChIKey | QXORIDJTWWOMPZ-CAWMZFRYSA-N |
| XLogP | 5.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|