C18H20F3NO2 — CID 6364826
[(E)-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-(trifluoromethyl)benzoate (PubChem CID 6364826) has the molecular formula C18H20F3NO2 and a molecular weight of 339.36 g/mol. Its IUPAC name is [(E)-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-(trifluoromethyl)benzoate.
| Compound Name | [(E)-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 6364826 |
| Molecular Formula | C18H20F3NO2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [(E)-[(1R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-(trifluoromethyl)benzoate |
| SMILES | CC1(C)/C(=N/OC(=O)c2cccc(C(F)(F)F)c2)[C@]2(C)CCC1C2 |
| InChI | InChI=1S/C18H20F3NO2/c1-16(2)13-7-8-17(3,10-13)15(16)22-24-14(23)11-5-4-6-12(9-11)18(19,20)21/h4-6,9,13H,7-8,10H2,1-3H3/b22-15-/t13?,17-/m1/s1 |
| InChIKey | GVRAGWKCKYOGKM-KFZOWFBCSA-N |
| XLogP | 5.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|